C23H20N4O4 — CID 91610079
N-(2-methylquinolin-4-yl)-N-[(5-methyl-2,4,6-trioxo-1,3-diazinan-5-yl)methyl]benzamide (PubChem CID 91610079) has the molecular formula C23H20N4O4 and a molecular weight of 416.44 g/mol. Its IUPAC name is N-(2-methylquinolin-4-yl)-N-[(5-methyl-2,4,6-trioxo-1,3-diazinan-5-yl)methyl]benzamide.
| Compound Name | N-(2-methylquinolin-4-yl)-N-[(5-methyl-2,4,6-trioxo-1,3-diazinan-5-yl)methyl]benzamide |
|---|---|
| PubChem CID | 91610079 |
| Molecular Formula | C23H20N4O4 |
| Molecular Weight | 416.44 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | N-(2-methylquinolin-4-yl)-N-[(5-methyl-2,4,6-trioxo-1,3-diazinan-5-yl)methyl]benzamide |
| SMILES | Cc1cc(N(CC2(C)C(=O)NC(=O)NC2=O)C(=O)c2ccccc2)c2ccccc2n1 |
| InChI | InChI=1S/C23H20N4O4/c1-14-12-18(16-10-6-7-11-17(16)24-14)27(19(28)15-8-4-3-5-9-15)13-23(2)20(29)25-22(31)26-21(23)30/h3-12H,13H2,1-2H3,(H2,25,26,29,30,31) |
| InChIKey | SQYWGKALRSCKCA-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 108.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.44 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|