C17H30O — CID 91611059
4-[(7-methylcyclohepta-1,3-dien-1-yl)methyl]octan-4-ol (PubChem CID 91611059) has the molecular formula C17H30O and a molecular weight of 250.43 g/mol. Its IUPAC name is 4-[(7-methylcyclohepta-1,3-dien-1-yl)methyl]octan-4-ol.
| Compound Name | 4-[(7-methylcyclohepta-1,3-dien-1-yl)methyl]octan-4-ol |
|---|---|
| PubChem CID | 91611059 |
| Molecular Formula | C17H30O |
| Molecular Weight | 250.43 g/mol |
| Exact Mass | 250.23 |
| IUPAC Name | 4-[(7-methylcyclohepta-1,3-dien-1-yl)methyl]octan-4-ol |
| SMILES | CCCCC(O)(CCC)CC1=CC=CCCC1C |
| InChI | InChI=1S/C17H30O/c1-4-6-13-17(18,12-5-2)14-16-11-9-7-8-10-15(16)3/h7,9,11,15,18H,4-6,8,10,12-14H2,1-3H3 |
| InChIKey | FXJAKWMUPXXTIH-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.43 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |