About 6-chloro-2-fluoro-4-methyl-3-propan-2-yl-4,5-dihydro-3H-azepine
6-chloro-2-fluoro-4-methyl-3-propan-2-yl-4,5-dihydro-3H-azepine (PubChem CID 91611702) has the molecular formula C10H15ClFN
and a molecular weight of 203.69 g/mol. Its IUPAC name is 6-chloro-2-fluoro-4-methyl-3-propan-2-yl-4,5-dihydro-3H-azepine.
Molecular Properties
| Compound Name | 6-chloro-2-fluoro-4-methyl-3-propan-2-yl-4,5-dihydro-3H-azepine |
| PubChem CID | 91611702 |
| Molecular Formula | C10H15ClFN |
| Molecular Weight | 203.69 g/mol |
| Exact Mass | 203.09 |
| IUPAC Name | 6-chloro-2-fluoro-4-methyl-3-propan-2-yl-4,5-dihydro-3H-azepine |
| SMILES | CC(C)C1C(F)=NC=C(Cl)CC1C |
| InChI | InChI=1S/C10H15ClFN/c1-6(2)9-7(3)4-8(11)5-13-10(9)12/h5-7,9H,4H2,1-3H3 |
| InChIKey | MIYINXMGXBPLBC-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.69 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-chloro-2-fluoro-4-methyl-3-propan-2-yl-4,5-dihydro-3H-azepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-2-fluoro-4-methyl-3-propan-2-yl-4,5-dihydro-3H-azepine?
The IUPAC name of 6-chloro-2-fluoro-4-methyl-3-propan-2-yl-4,5-dihydro-3H-azepine (CID 91611702) is 6-chloro-2-fluoro-4-methyl-3-propan-2-yl-4,5-dihydro-3H-azepine.
What is the SMILES notation for 6-chloro-2-fluoro-4-methyl-3-propan-2-yl-4,5-dihydro-3H-azepine?
The canonical SMILES for 6-chloro-2-fluoro-4-methyl-3-propan-2-yl-4,5-dihydro-3H-azepine is CC(C)C1C(F)=NC=C(Cl)CC1C.
What is the InChIKey of 6-chloro-2-fluoro-4-methyl-3-propan-2-yl-4,5-dihydro-3H-azepine?
The InChIKey is MIYINXMGXBPLBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15ClFN/c1-6(2)9-7(3)4-8(11)5-13-10(9)12/h5-7,9H,4H2,1-3H3.
What are the key properties of 6-chloro-2-fluoro-4-methyl-3-propan-2-yl-4,5-dihydro-3H-azepine?
6-chloro-2-fluoro-4-methyl-3-propan-2-yl-4,5-dihydro-3H-azepine has a molecular weight of 203.69 g/mol, XLogP of 3.75, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-2-fluoro-4-methyl-3-propan-2-yl-4,5-dihydro-3H-azepine is sourced from PubChem (CID 91611702), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).