C20H29N3O4 — CID 91613200
methyl-[4-methyl-1-oxo-1-[4-(phenylmethoxyamino)-3,6-dihydro-2H-pyridin-1-yl]pentan-2-yl]carbamic acid (PubChem CID 91613200) has the molecular formula C20H29N3O4 and a molecular weight of 375.47 g/mol. Its IUPAC name is methyl-[4-methyl-1-oxo-1-[4-(phenylmethoxyamino)-3,6-dihydro-2H-pyridin-1-yl]pentan-2-yl]carbamic acid.
| Compound Name | methyl-[4-methyl-1-oxo-1-[4-(phenylmethoxyamino)-3,6-dihydro-2H-pyridin-1-yl]pentan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 91613200 |
| Molecular Formula | C20H29N3O4 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.22 |
| IUPAC Name | methyl-[4-methyl-1-oxo-1-[4-(phenylmethoxyamino)-3,6-dihydro-2H-pyridin-1-yl]pentan-2-yl]carbamic acid |
| SMILES | CC(C)CC(C(=O)N1CC=C(NOCc2ccccc2)CC1)N(C)C(=O)O |
| InChI | InChI=1S/C20H29N3O4/c1-15(2)13-18(22(3)20(25)26)19(24)23-11-9-17(10-12-23)21-27-14-16-7-5-4-6-8-16/h4-9,15,18,21H,10-14H2,1-3H3,(H,25,26) |
| InChIKey | GDQRIMKVAJXQRO-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 82.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|