C14H25N4+3 — CID 91613483
1-methyl-3-[6-(3-methyl-1H-imidazole-1,3-diium-1-yl)hexyl]imidazol-1-ium (PubChem CID 91613483) has the molecular formula C14H25N4+3 and a molecular weight of 249.38 g/mol. Its IUPAC name is 1-methyl-3-[6-(3-methyl-1H-imidazole-1,3-diium-1-yl)hexyl]imidazol-1-ium.
| Compound Name | 1-methyl-3-[6-(3-methyl-1H-imidazole-1,3-diium-1-yl)hexyl]imidazol-1-ium |
|---|---|
| PubChem CID | 91613483 |
| Molecular Formula | C14H25N4+3 |
| Molecular Weight | 249.38 g/mol |
| Exact Mass | 249.21 |
| IUPAC Name | 1-methyl-3-[6-(3-methyl-1H-imidazole-1,3-diium-1-yl)hexyl]imidazol-1-ium |
| SMILES | C[N+]1=C[NH+](CCCCCCn2cc[n+](C)c2)C=C1 |
| InChI | InChI=1S/C14H24N4/c1-15-9-11-17(13-15)7-5-3-4-6-8-18-12-10-16(2)14-18/h9-14H,3-8H2,1-2H3/q+2/p+1 |
| InChIKey | QADKPXXGGLHNBS-UHFFFAOYSA-O |
| XLogP | -0.09 |
| TPSA | 16.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.38 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|