C28H45NO4 — CID 91614550
trans-(1R,3S)-5-[2-[(1R,3aS,7aR)-7a-methyl-1-[(2S)-1-(2-propoxyiminopropoxy)propan-2-yl]-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexane-1,3-diol (PubChem CID 91614550) has the molecular formula C28H45NO4 and a molecular weight of 459.67 g/mol. Its IUPAC name is trans-(1R,3S)-5-[2-[(1R,3aS,7aR)-7a-methyl-1-[(2S)-1-(2-propoxyiminopropoxy)propan-2-yl]-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexane-1,3-diol.
| Compound Name | trans-(1R,3S)-5-[2-[(1R,3aS,7aR)-7a-methyl-1-[(2S)-1-(2-propoxyiminopropoxy)propan-2-yl]-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexane-1,3-diol |
|---|---|
| PubChem CID | 91614550 |
| Molecular Formula | C28H45NO4 |
| Molecular Weight | 459.67 g/mol |
| Exact Mass | 459.33 |
| IUPAC Name | trans-(1R,3S)-5-[2-[(1R,3aS,7aR)-7a-methyl-1-[(2S)-1-(2-propoxyiminopropoxy)propan-2-yl]-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexane-1,3-diol |
| SMILES | C=C1C(=CC=C2CCC[C@]3(C)[C@@H]([C@H](C)COCC(C)=NOCCC)CC[C@@H]23)C[C@@H](O)C[C@@H]1O |
| InChI | InChI=1S/C28H45NO4/c1-6-14-33-29-20(3)18-32-17-19(2)25-11-12-26-22(8-7-13-28(25,26)5)9-10-23-15-24(30)16-27(31)21(23)4/h9-10,19,24-27,30-31H,4,6-8,11-18H2,1-3,5H3/t19-,24-,25-,26+,27+,28-/m1/s1 |
| InChIKey | WBAMTGAYRVESLY-PCSGDSHESA-N |
| XLogP | 5.58 |
| TPSA | 71.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.67 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|