C9H22N2O — CID 91618735
4-[amino(methyl)amino]-2,5-dimethylhexan-3-ol (PubChem CID 91618735) has the molecular formula C9H22N2O and a molecular weight of 174.29 g/mol. Its IUPAC name is 4-[amino(methyl)amino]-2,5-dimethylhexan-3-ol.
| Compound Name | 4-[amino(methyl)amino]-2,5-dimethylhexan-3-ol |
|---|---|
| PubChem CID | 91618735 |
| Molecular Formula | C9H22N2O |
| Molecular Weight | 174.29 g/mol |
| Exact Mass | 174.17 |
| IUPAC Name | 4-[amino(methyl)amino]-2,5-dimethylhexan-3-ol |
| SMILES | CC(C)C(O)C(C(C)C)N(C)N |
| InChI | InChI=1S/C9H22N2O/c1-6(2)8(11(5)10)9(12)7(3)4/h6-9,12H,10H2,1-5H3 |
| InChIKey | AVVWLPJBTMQDLR-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.29 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|