C10H10F3N — CID 91619096
2,2,5-trifluoro-7-methyl-1,3-dihydroinden-1-amine (PubChem CID 91619096) has the molecular formula C10H10F3N and a molecular weight of 201.19 g/mol. Its IUPAC name is 2,2,5-trifluoro-7-methyl-1,3-dihydroinden-1-amine.
| Compound Name | 2,2,5-trifluoro-7-methyl-1,3-dihydroinden-1-amine |
|---|---|
| PubChem CID | 91619096 |
| Molecular Formula | C10H10F3N |
| Molecular Weight | 201.19 g/mol |
| Exact Mass | 201.08 |
| IUPAC Name | 2,2,5-trifluoro-7-methyl-1,3-dihydroinden-1-amine |
| SMILES | Cc1cc(F)cc2c1C(N)C(F)(F)C2 |
| InChI | InChI=1S/C10H10F3N/c1-5-2-7(11)3-6-4-10(12,13)9(14)8(5)6/h2-3,9H,4,14H2,1H3 |
| InChIKey | SNYNLFVNEGBTPL-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.19 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |