C11H11NOS — CID 91620842
(3-methyl-1,2-thiazol-5-yl)-phenylmethanol (PubChem CID 91620842) has the molecular formula C11H11NOS and a molecular weight of 205.28 g/mol. Its IUPAC name is (3-methyl-1,2-thiazol-5-yl)-phenylmethanol.
| Compound Name | (3-methyl-1,2-thiazol-5-yl)-phenylmethanol |
|---|---|
| PubChem CID | 91620842 |
| Molecular Formula | C11H11NOS |
| Molecular Weight | 205.28 g/mol |
| Exact Mass | 205.06 |
| IUPAC Name | (3-methyl-1,2-thiazol-5-yl)-phenylmethanol |
| SMILES | Cc1cc(C(O)c2ccccc2)sn1 |
| InChI | InChI=1S/C11H11NOS/c1-8-7-10(14-12-8)11(13)9-5-3-2-4-6-9/h2-7,11,13H,1H3 |
| InChIKey | AVQDKTPFMZLMPU-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.28 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |