C10H7FINOS — CID 58221419
(2-fluoro-5-iodophenyl)-(1,2-thiazol-5-yl)methanol (PubChem CID 58221419) has the molecular formula C10H7FINOS and a molecular weight of 335.14 g/mol. Its IUPAC name is (2-fluoro-5-iodophenyl)-(1,2-thiazol-5-yl)methanol.
| Compound Name | (2-fluoro-5-iodophenyl)-(1,2-thiazol-5-yl)methanol |
|---|---|
| PubChem CID | 58221419 |
| Molecular Formula | C10H7FINOS |
| Molecular Weight | 335.14 g/mol |
| Exact Mass | 334.93 |
| IUPAC Name | (2-fluoro-5-iodophenyl)-(1,2-thiazol-5-yl)methanol |
| SMILES | OC(c1ccns1)c1cc(I)ccc1F |
| InChI | InChI=1S/C10H7FINOS/c11-8-2-1-6(12)5-7(8)10(14)9-3-4-13-15-9/h1-5,10,14H |
| InChIKey | VCSGTFWBQXJVTE-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.14 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|