C7H10N2O3S2 — CID 91623532
N-methoxy-N-methyl-2-(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)acetamide (PubChem CID 91623532) has the molecular formula C7H10N2O3S2 and a molecular weight of 234.30 g/mol. Its IUPAC name is N-methoxy-N-methyl-2-(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)acetamide.
| Compound Name | N-methoxy-N-methyl-2-(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)acetamide |
|---|---|
| PubChem CID | 91623532 |
| Molecular Formula | C7H10N2O3S2 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.01 |
| IUPAC Name | N-methoxy-N-methyl-2-(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)acetamide |
| SMILES | CON(C)C(=O)CN1C(=O)CSC1=S |
| InChI | InChI=1S/C7H10N2O3S2/c1-8(12-2)5(10)3-9-6(11)4-14-7(9)13/h3-4H2,1-2H3 |
| InChIKey | DAFZHUNGCWILSE-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'rhod_sat_A(33)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|