C16H18FN3O3S — CID 91626438
N-[4-(5-fluoropyrimidin-2-yl)oxycyclohexyl]benzenesulfonamide (PubChem CID 91626438) has the molecular formula C16H18FN3O3S and a molecular weight of 351.40 g/mol. Its IUPAC name is N-[4-(5-fluoropyrimidin-2-yl)oxycyclohexyl]benzenesulfonamide.
| Compound Name | N-[4-(5-fluoropyrimidin-2-yl)oxycyclohexyl]benzenesulfonamide |
|---|---|
| PubChem CID | 91626438 |
| Molecular Formula | C16H18FN3O3S |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | N-[4-(5-fluoropyrimidin-2-yl)oxycyclohexyl]benzenesulfonamide |
| SMILES | O=S(=O)(NC1CCC(Oc2ncc(F)cn2)CC1)c1ccccc1 |
| InChI | InChI=1S/C16H18FN3O3S/c17-12-10-18-16(19-11-12)23-14-8-6-13(7-9-14)20-24(21,22)15-4-2-1-3-5-15/h1-5,10-11,13-14,20H,6-9H2 |
| InChIKey | KEPYRCSAQWTQMW-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |