C19H17ClN2O2 — CID 91630558
3-(3-chlorophenyl)-N-[[2-(furan-2-yl)-3-pyridinyl]methyl]propanamide (PubChem CID 91630558) has the molecular formula C19H17ClN2O2 and a molecular weight of 340.81 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-N-[[2-(furan-2-yl)-3-pyridinyl]methyl]propanamide.
| Compound Name | 3-(3-chlorophenyl)-N-[[2-(furan-2-yl)-3-pyridinyl]methyl]propanamide |
|---|---|
| PubChem CID | 91630558 |
| Molecular Formula | C19H17ClN2O2 |
| Molecular Weight | 340.81 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | 3-(3-chlorophenyl)-N-[[2-(furan-2-yl)-3-pyridinyl]methyl]propanamide |
| SMILES | O=C(CCc1cccc(Cl)c1)NCc1cccnc1-c1ccco1 |
| InChI | InChI=1S/C19H17ClN2O2/c20-16-6-1-4-14(12-16)8-9-18(23)22-13-15-5-2-10-21-19(15)17-7-3-11-24-17/h1-7,10-12H,8-9,13H2,(H,22,23) |
| InChIKey | KPRCKUNUSVREMD-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.81 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |