C16H12ClN3O2 — CID 121198851
3-chloro-N-[[3-(furan-2-yl)pyrazin-2-yl]methyl]benzamide (PubChem CID 121198851) has the molecular formula C16H12ClN3O2 and a molecular weight of 313.74 g/mol. Its IUPAC name is 3-chloro-N-[[3-(furan-2-yl)pyrazin-2-yl]methyl]benzamide.
| Compound Name | 3-chloro-N-[[3-(furan-2-yl)pyrazin-2-yl]methyl]benzamide |
|---|---|
| PubChem CID | 121198851 |
| Molecular Formula | C16H12ClN3O2 |
| Molecular Weight | 313.74 g/mol |
| Exact Mass | 313.06 |
| IUPAC Name | 3-chloro-N-[[3-(furan-2-yl)pyrazin-2-yl]methyl]benzamide |
| SMILES | O=C(NCc1nccnc1-c1ccco1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C16H12ClN3O2/c17-12-4-1-3-11(9-12)16(21)20-10-13-15(19-7-6-18-13)14-5-2-8-22-14/h1-9H,10H2,(H,20,21) |
| InChIKey | VMRBQQGIEOIWDI-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.74 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |