C20H15N3O2S — CID 119105875
N-[[3-(furan-2-yl)pyrazin-2-yl]methyl]-4-thiophen-2-ylbenzamide (PubChem CID 119105875) has the molecular formula C20H15N3O2S and a molecular weight of 361.43 g/mol. Its IUPAC name is N-[[3-(furan-2-yl)pyrazin-2-yl]methyl]-4-thiophen-2-ylbenzamide.
| Compound Name | N-[[3-(furan-2-yl)pyrazin-2-yl]methyl]-4-thiophen-2-ylbenzamide |
|---|---|
| PubChem CID | 119105875 |
| Molecular Formula | C20H15N3O2S |
| Molecular Weight | 361.43 g/mol |
| Exact Mass | 361.09 |
| IUPAC Name | N-[[3-(furan-2-yl)pyrazin-2-yl]methyl]-4-thiophen-2-ylbenzamide |
| SMILES | O=C(NCc1nccnc1-c1ccco1)c1ccc(-c2cccs2)cc1 |
| InChI | InChI=1S/C20H15N3O2S/c24-20(15-7-5-14(6-8-15)18-4-2-12-26-18)23-13-16-19(22-10-9-21-16)17-3-1-11-25-17/h1-12H,13H2,(H,23,24) |
| InChIKey | PVNXWNDQIODZOH-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.43 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |