C15H13N3O2S — CID 121198890
N-[[3-(furan-2-yl)pyrazin-2-yl]methyl]-5-methylthiophene-2-carboxamide (PubChem CID 121198890) has the molecular formula C15H13N3O2S and a molecular weight of 299.36 g/mol. Its IUPAC name is N-[[3-(furan-2-yl)pyrazin-2-yl]methyl]-5-methylthiophene-2-carboxamide.
| Compound Name | N-[[3-(furan-2-yl)pyrazin-2-yl]methyl]-5-methylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 121198890 |
| Molecular Formula | C15H13N3O2S |
| Molecular Weight | 299.36 g/mol |
| Exact Mass | 299.07 |
| IUPAC Name | N-[[3-(furan-2-yl)pyrazin-2-yl]methyl]-5-methylthiophene-2-carboxamide |
| SMILES | Cc1ccc(C(=O)NCc2nccnc2-c2ccco2)s1 |
| InChI | InChI=1S/C15H13N3O2S/c1-10-4-5-13(21-10)15(19)18-9-11-14(17-7-6-16-11)12-3-2-8-20-12/h2-8H,9H2,1H3,(H,18,19) |
| InChIKey | UBGFQTXEBPNBIQ-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.36 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |