C14H13N3O3S2 — CID 121023148
N-[[3-(furan-2-yl)pyrazin-2-yl]methyl]-5-methylthiophene-2-sulfonamide (PubChem CID 121023148) has the molecular formula C14H13N3O3S2 and a molecular weight of 335.41 g/mol. Its IUPAC name is N-[[3-(furan-2-yl)pyrazin-2-yl]methyl]-5-methylthiophene-2-sulfonamide.
| Compound Name | N-[[3-(furan-2-yl)pyrazin-2-yl]methyl]-5-methylthiophene-2-sulfonamide |
|---|---|
| PubChem CID | 121023148 |
| Molecular Formula | C14H13N3O3S2 |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.04 |
| IUPAC Name | N-[[3-(furan-2-yl)pyrazin-2-yl]methyl]-5-methylthiophene-2-sulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NCc2nccnc2-c2ccco2)s1 |
| InChI | InChI=1S/C14H13N3O3S2/c1-10-4-5-13(21-10)22(18,19)17-9-11-14(16-7-6-15-11)12-3-2-8-20-12/h2-8,17H,9H2,1H3 |
| InChIKey | CEVWUJXJSDIBBO-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |