C13H16N4O4S — CID 121199085
N-[[3-(furan-2-yl)pyrazin-2-yl]methyl]morpholine-4-sulfonamide (PubChem CID 121199085) has the molecular formula C13H16N4O4S and a molecular weight of 324.36 g/mol. Its IUPAC name is N-[[3-(furan-2-yl)pyrazin-2-yl]methyl]morpholine-4-sulfonamide.
| Compound Name | N-[[3-(furan-2-yl)pyrazin-2-yl]methyl]morpholine-4-sulfonamide |
|---|---|
| PubChem CID | 121199085 |
| Molecular Formula | C13H16N4O4S |
| Molecular Weight | 324.36 g/mol |
| Exact Mass | 324.09 |
| IUPAC Name | N-[[3-(furan-2-yl)pyrazin-2-yl]methyl]morpholine-4-sulfonamide |
| SMILES | O=S(=O)(NCc1nccnc1-c1ccco1)N1CCOCC1 |
| InChI | InChI=1S/C13H16N4O4S/c18-22(19,17-5-8-20-9-6-17)16-10-11-13(15-4-3-14-11)12-2-1-7-21-12/h1-4,7,16H,5-6,8-10H2 |
| InChIKey | MOSMDJLBWAOGEQ-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 97.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.36 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |