C22H25N3O5 — CID 121198864
3,4,5-triethoxy-N-[[3-(furan-2-yl)pyrazin-2-yl]methyl]benzamide (PubChem CID 121198864) has the molecular formula C22H25N3O5 and a molecular weight of 411.46 g/mol. Its IUPAC name is 3,4,5-triethoxy-N-[[3-(furan-2-yl)pyrazin-2-yl]methyl]benzamide.
| Compound Name | 3,4,5-triethoxy-N-[[3-(furan-2-yl)pyrazin-2-yl]methyl]benzamide |
|---|---|
| PubChem CID | 121198864 |
| Molecular Formula | C22H25N3O5 |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | 3,4,5-triethoxy-N-[[3-(furan-2-yl)pyrazin-2-yl]methyl]benzamide |
| SMILES | CCOc1cc(C(=O)NCc2nccnc2-c2ccco2)cc(OCC)c1OCC |
| InChI | InChI=1S/C22H25N3O5/c1-4-27-18-12-15(13-19(28-5-2)21(18)29-6-3)22(26)25-14-16-20(24-10-9-23-16)17-8-7-11-30-17/h7-13H,4-6,14H2,1-3H3,(H,25,26) |
| InChIKey | HJXWHQBPDRVOQU-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 95.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |