C22H25N3O4S — CID 122276832
3,4,5-triethoxy-N-[(3-thiophen-3-ylpyrazin-2-yl)methyl]benzamide (PubChem CID 122276832) has the molecular formula C22H25N3O4S and a molecular weight of 427.53 g/mol. Its IUPAC name is 3,4,5-triethoxy-N-[(3-thiophen-3-ylpyrazin-2-yl)methyl]benzamide.
| Compound Name | 3,4,5-triethoxy-N-[(3-thiophen-3-ylpyrazin-2-yl)methyl]benzamide |
|---|---|
| PubChem CID | 122276832 |
| Molecular Formula | C22H25N3O4S |
| Molecular Weight | 427.53 g/mol |
| Exact Mass | 427.16 |
| IUPAC Name | 3,4,5-triethoxy-N-[(3-thiophen-3-ylpyrazin-2-yl)methyl]benzamide |
| SMILES | CCOc1cc(C(=O)NCc2nccnc2-c2ccsc2)cc(OCC)c1OCC |
| InChI | InChI=1S/C22H25N3O4S/c1-4-27-18-11-16(12-19(28-5-2)21(18)29-6-3)22(26)25-13-17-20(24-9-8-23-17)15-7-10-30-14-15/h7-12,14H,4-6,13H2,1-3H3,(H,25,26) |
| InChIKey | DRUMZUOHBWDTSE-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 82.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.53 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |