C16H11F2N3OS — CID 122162296
2,6-difluoro-N-[(3-thiophen-3-ylpyrazin-2-yl)methyl]benzamide (PubChem CID 122162296) has the molecular formula C16H11F2N3OS and a molecular weight of 331.35 g/mol. Its IUPAC name is 2,6-difluoro-N-[(3-thiophen-3-ylpyrazin-2-yl)methyl]benzamide.
| Compound Name | 2,6-difluoro-N-[(3-thiophen-3-ylpyrazin-2-yl)methyl]benzamide |
|---|---|
| PubChem CID | 122162296 |
| Molecular Formula | C16H11F2N3OS |
| Molecular Weight | 331.35 g/mol |
| Exact Mass | 331.06 |
| IUPAC Name | 2,6-difluoro-N-[(3-thiophen-3-ylpyrazin-2-yl)methyl]benzamide |
| SMILES | O=C(NCc1nccnc1-c1ccsc1)c1c(F)cccc1F |
| InChI | InChI=1S/C16H11F2N3OS/c17-11-2-1-3-12(18)14(11)16(22)21-8-13-15(20-6-5-19-13)10-4-7-23-9-10/h1-7,9H,8H2,(H,21,22) |
| InChIKey | WMWHCUZFSZFXTF-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.35 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |