C16H12BrN3OS — CID 122246168
2-bromo-N-[(3-thiophen-3-ylpyrazin-2-yl)methyl]benzamide (PubChem CID 122246168) has the molecular formula C16H12BrN3OS and a molecular weight of 374.26 g/mol. Its IUPAC name is 2-bromo-N-[(3-thiophen-3-ylpyrazin-2-yl)methyl]benzamide.
| Compound Name | 2-bromo-N-[(3-thiophen-3-ylpyrazin-2-yl)methyl]benzamide |
|---|---|
| PubChem CID | 122246168 |
| Molecular Formula | C16H12BrN3OS |
| Molecular Weight | 374.26 g/mol |
| Exact Mass | 372.99 |
| IUPAC Name | 2-bromo-N-[(3-thiophen-3-ylpyrazin-2-yl)methyl]benzamide |
| SMILES | O=C(NCc1nccnc1-c1ccsc1)c1ccccc1Br |
| InChI | InChI=1S/C16H12BrN3OS/c17-13-4-2-1-3-12(13)16(21)20-9-14-15(19-7-6-18-14)11-5-8-22-10-11/h1-8,10H,9H2,(H,20,21) |
| InChIKey | PCNKQBJNUFIOEF-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.26 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |