C20H15N3OS2 — CID 122162295
4-thiophen-2-yl-N-[(3-thiophen-3-ylpyrazin-2-yl)methyl]benzamide (PubChem CID 122162295) has the molecular formula C20H15N3OS2 and a molecular weight of 377.49 g/mol. Its IUPAC name is 4-thiophen-2-yl-N-[(3-thiophen-3-ylpyrazin-2-yl)methyl]benzamide.
| Compound Name | 4-thiophen-2-yl-N-[(3-thiophen-3-ylpyrazin-2-yl)methyl]benzamide |
|---|---|
| PubChem CID | 122162295 |
| Molecular Formula | C20H15N3OS2 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.07 |
| IUPAC Name | 4-thiophen-2-yl-N-[(3-thiophen-3-ylpyrazin-2-yl)methyl]benzamide |
| SMILES | O=C(NCc1nccnc1-c1ccsc1)c1ccc(-c2cccs2)cc1 |
| InChI | InChI=1S/C20H15N3OS2/c24-20(15-5-3-14(4-6-15)18-2-1-10-26-18)23-12-17-19(22-9-8-21-17)16-7-11-25-13-16/h1-11,13H,12H2,(H,23,24) |
| InChIKey | YSDGJTQOUWPEPK-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |