C13H16N4OS — CID 122276968
1-propyl-3-[(3-thiophen-3-ylpyrazin-2-yl)methyl]urea (PubChem CID 122276968) has the molecular formula C13H16N4OS and a molecular weight of 276.37 g/mol. Its IUPAC name is 1-propyl-3-[(3-thiophen-3-ylpyrazin-2-yl)methyl]urea.
| Compound Name | 1-propyl-3-[(3-thiophen-3-ylpyrazin-2-yl)methyl]urea |
|---|---|
| PubChem CID | 122276968 |
| Molecular Formula | C13H16N4OS |
| Molecular Weight | 276.37 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | 1-propyl-3-[(3-thiophen-3-ylpyrazin-2-yl)methyl]urea |
| SMILES | CCCNC(=O)NCc1nccnc1-c1ccsc1 |
| InChI | InChI=1S/C13H16N4OS/c1-2-4-16-13(18)17-8-11-12(15-6-5-14-11)10-3-7-19-9-10/h3,5-7,9H,2,4,8H2,1H3,(H2,16,17,18) |
| InChIKey | ABRQNGJDPFIOJT-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.37 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |