C17H14N4O3S — CID 122276988
1-(1,3-benzodioxol-5-yl)-3-[(3-thiophen-3-ylpyrazin-2-yl)methyl]urea (PubChem CID 122276988) has the molecular formula C17H14N4O3S and a molecular weight of 354.39 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-3-[(3-thiophen-3-ylpyrazin-2-yl)methyl]urea.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-3-[(3-thiophen-3-ylpyrazin-2-yl)methyl]urea |
|---|---|
| PubChem CID | 122276988 |
| Molecular Formula | C17H14N4O3S |
| Molecular Weight | 354.39 g/mol |
| Exact Mass | 354.08 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-3-[(3-thiophen-3-ylpyrazin-2-yl)methyl]urea |
| SMILES | O=C(NCc1nccnc1-c1ccsc1)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C17H14N4O3S/c22-17(21-12-1-2-14-15(7-12)24-10-23-14)20-8-13-16(19-5-4-18-13)11-3-6-25-9-11/h1-7,9H,8,10H2,(H2,20,21,22) |
| InChIKey | QRBRJPMICRSRDX-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.39 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |