C19H15N5OS — CID 122276944
1-quinolin-6-yl-3-[(3-thiophen-3-ylpyrazin-2-yl)methyl]urea (PubChem CID 122276944) has the molecular formula C19H15N5OS and a molecular weight of 361.43 g/mol. Its IUPAC name is 1-quinolin-6-yl-3-[(3-thiophen-3-ylpyrazin-2-yl)methyl]urea.
| Compound Name | 1-quinolin-6-yl-3-[(3-thiophen-3-ylpyrazin-2-yl)methyl]urea |
|---|---|
| PubChem CID | 122276944 |
| Molecular Formula | C19H15N5OS |
| Molecular Weight | 361.43 g/mol |
| Exact Mass | 361.10 |
| IUPAC Name | 1-quinolin-6-yl-3-[(3-thiophen-3-ylpyrazin-2-yl)methyl]urea |
| SMILES | O=C(NCc1nccnc1-c1ccsc1)Nc1ccc2ncccc2c1 |
| InChI | InChI=1S/C19H15N5OS/c25-19(24-15-3-4-16-13(10-15)2-1-6-20-16)23-11-17-18(22-8-7-21-17)14-5-9-26-12-14/h1-10,12H,11H2,(H2,23,24,25) |
| InChIKey | AHZAJRDXOUQZDL-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.43 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |