C18H14F3N3O2 — CID 121198894
N-[[3-(furan-2-yl)pyrazin-2-yl]methyl]-2-[4-(trifluoromethyl)phenyl]acetamide (PubChem CID 121198894) has the molecular formula C18H14F3N3O2 and a molecular weight of 361.32 g/mol. Its IUPAC name is N-[[3-(furan-2-yl)pyrazin-2-yl]methyl]-2-[4-(trifluoromethyl)phenyl]acetamide.
| Compound Name | N-[[3-(furan-2-yl)pyrazin-2-yl]methyl]-2-[4-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 121198894 |
| Molecular Formula | C18H14F3N3O2 |
| Molecular Weight | 361.32 g/mol |
| Exact Mass | 361.10 |
| IUPAC Name | N-[[3-(furan-2-yl)pyrazin-2-yl]methyl]-2-[4-(trifluoromethyl)phenyl]acetamide |
| SMILES | O=C(Cc1ccc(C(F)(F)F)cc1)NCc1nccnc1-c1ccco1 |
| InChI | InChI=1S/C18H14F3N3O2/c19-18(20,21)13-5-3-12(4-6-13)10-16(25)24-11-14-17(23-8-7-22-14)15-2-1-9-26-15/h1-9H,10-11H2,(H,24,25) |
| InChIKey | KSORBXLEWCCPBS-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.32 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |