C16H19F3N6O — CID 91631411
1-ethyl-N-[1-[6-(trifluoromethyl)pyrimidin-4-yl]piperidin-4-yl]pyrazole-3-carboxamide (PubChem CID 91631411) has the molecular formula C16H19F3N6O and a molecular weight of 368.36 g/mol. Its IUPAC name is 1-ethyl-N-[1-[6-(trifluoromethyl)pyrimidin-4-yl]piperidin-4-yl]pyrazole-3-carboxamide.
| Compound Name | 1-ethyl-N-[1-[6-(trifluoromethyl)pyrimidin-4-yl]piperidin-4-yl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 91631411 |
| Molecular Formula | C16H19F3N6O |
| Molecular Weight | 368.36 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | 1-ethyl-N-[1-[6-(trifluoromethyl)pyrimidin-4-yl]piperidin-4-yl]pyrazole-3-carboxamide |
| SMILES | CCn1ccc(C(=O)NC2CCN(c3cc(C(F)(F)F)ncn3)CC2)n1 |
| InChI | InChI=1S/C16H19F3N6O/c1-2-25-8-5-12(23-25)15(26)22-11-3-6-24(7-4-11)14-9-13(16(17,18)19)20-10-21-14/h5,8-11H,2-4,6-7H2,1H3,(H,22,26) |
| InChIKey | SRBCATPAESIDFJ-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.36 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |