C11H6BrCl2N3O2 — CID 91641935
N-(5-bromo-2-oxo-1H-pyridin-3-yl)-2,6-dichloropyridine-3-carboxamide (PubChem CID 91641935) has the molecular formula C11H6BrCl2N3O2 and a molecular weight of 363.00 g/mol. Its IUPAC name is N-(5-bromo-2-oxo-1H-pyridin-3-yl)-2,6-dichloropyridine-3-carboxamide.
| Compound Name | N-(5-bromo-2-oxo-1H-pyridin-3-yl)-2,6-dichloropyridine-3-carboxamide |
|---|---|
| PubChem CID | 91641935 |
| Molecular Formula | C11H6BrCl2N3O2 |
| Molecular Weight | 363.00 g/mol |
| Exact Mass | 360.90 |
| IUPAC Name | N-(5-bromo-2-oxo-1H-pyridin-3-yl)-2,6-dichloropyridine-3-carboxamide |
| SMILES | O=C(Nc1cc(Br)c[nH]c1=O)c1ccc(Cl)nc1Cl |
| InChI | InChI=1S/C11H6BrCl2N3O2/c12-5-3-7(11(19)15-4-5)16-10(18)6-1-2-8(13)17-9(6)14/h1-4H,(H,15,19)(H,16,18) |
| InChIKey | KATZJIFGTNDMNL-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.00 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|