C19H21N3O3 — CID 91642886
1-[2-[4-(4-methylpyrimidin-2-yl)anilino]-2-oxoethyl]cyclopentane-1-carboxylic acid (PubChem CID 91642886) has the molecular formula C19H21N3O3 and a molecular weight of 339.40 g/mol. Its IUPAC name is 1-[2-[4-(4-methylpyrimidin-2-yl)anilino]-2-oxoethyl]cyclopentane-1-carboxylic acid.
| Compound Name | 1-[2-[4-(4-methylpyrimidin-2-yl)anilino]-2-oxoethyl]cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 91642886 |
| Molecular Formula | C19H21N3O3 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | 1-[2-[4-(4-methylpyrimidin-2-yl)anilino]-2-oxoethyl]cyclopentane-1-carboxylic acid |
| SMILES | Cc1ccnc(-c2ccc(NC(=O)CC3(C(=O)O)CCCC3)cc2)n1 |
| InChI | InChI=1S/C19H21N3O3/c1-13-8-11-20-17(21-13)14-4-6-15(7-5-14)22-16(23)12-19(18(24)25)9-2-3-10-19/h4-8,11H,2-3,9-10,12H2,1H3,(H,22,23)(H,24,25) |
| InChIKey | VQZIEESLMJSBIV-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |