C16H20N2O4 — CID 45312610
1-[2-[4-(methylcarbamoyl)anilino]-2-oxoethyl]cyclopentane-1-carboxylic acid (PubChem CID 45312610) has the molecular formula C16H20N2O4 and a molecular weight of 304.35 g/mol. Its IUPAC name is 1-[2-[4-(methylcarbamoyl)anilino]-2-oxoethyl]cyclopentane-1-carboxylic acid.
| Compound Name | 1-[2-[4-(methylcarbamoyl)anilino]-2-oxoethyl]cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 45312610 |
| Molecular Formula | C16H20N2O4 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | 1-[2-[4-(methylcarbamoyl)anilino]-2-oxoethyl]cyclopentane-1-carboxylic acid |
| SMILES | CNC(=O)c1ccc(NC(=O)CC2(C(=O)O)CCCC2)cc1 |
| InChI | InChI=1S/C16H20N2O4/c1-17-14(20)11-4-6-12(7-5-11)18-13(19)10-16(15(21)22)8-2-3-9-16/h4-7H,2-3,8-10H2,1H3,(H,17,20)(H,18,19)(H,21,22) |
| InChIKey | NICIKHFKZYTUOB-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |