About 1-[3,3-bis(trifluoromethyl)pyrrolidin-1-yl]-3-(4-nitrophenoxy)propan-1-one
1-[3,3-bis(trifluoromethyl)pyrrolidin-1-yl]-3-(4-nitrophenoxy)propan-1-one (PubChem CID 91642947) has the molecular formula C15H14F6N2O4
and a molecular weight of 400.28 g/mol. Its IUPAC name is 1-[3,3-bis(trifluoromethyl)pyrrolidin-1-yl]-3-(4-nitrophenoxy)propan-1-one.
Molecular Properties
| Compound Name | 1-[3,3-bis(trifluoromethyl)pyrrolidin-1-yl]-3-(4-nitrophenoxy)propan-1-one |
| PubChem CID | 91642947 |
| Molecular Formula | C15H14F6N2O4 |
| Molecular Weight | 400.28 g/mol |
| Exact Mass | 400.09 |
| IUPAC Name | 1-[3,3-bis(trifluoromethyl)pyrrolidin-1-yl]-3-(4-nitrophenoxy)propan-1-one |
| SMILES | O=C(CCOc1ccc([N+](=O)[O-])cc1)N1CCC(C(F)(F)F)(C(F)(F)F)C1 |
| InChI | InChI=1S/C15H14F6N2O4/c16-14(17,18)13(15(19,20)21)6-7-22(9-13)12(24)5-8-27-11-3-1-10(2-4-11)23(25)26/h1-4H,5-9H2 |
| InChIKey | YJEQMPWYPXIAFG-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 400.28 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-[3,3-bis(trifluoromethyl)pyrrolidin-1-yl]-3-(4-nitrophenoxy)propan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3,3-bis(trifluoromethyl)pyrrolidin-1-yl]-3-(4-nitrophenoxy)propan-1-one?
The IUPAC name of 1-[3,3-bis(trifluoromethyl)pyrrolidin-1-yl]-3-(4-nitrophenoxy)propan-1-one (CID 91642947) is 1-[3,3-bis(trifluoromethyl)pyrrolidin-1-yl]-3-(4-nitrophenoxy)propan-1-one.
What is the SMILES notation for 1-[3,3-bis(trifluoromethyl)pyrrolidin-1-yl]-3-(4-nitrophenoxy)propan-1-one?
The canonical SMILES for 1-[3,3-bis(trifluoromethyl)pyrrolidin-1-yl]-3-(4-nitrophenoxy)propan-1-one is O=C(CCOc1ccc([N+](=O)[O-])cc1)N1CCC(C(F)(F)F)(C(F)(F)F)C1.
What is the InChIKey of 1-[3,3-bis(trifluoromethyl)pyrrolidin-1-yl]-3-(4-nitrophenoxy)propan-1-one?
The InChIKey is YJEQMPWYPXIAFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14F6N2O4/c16-14(17,18)13(15(19,20)21)6-7-22(9-13)12(24)5-8-27-11-3-1-10(2-4-11)23(25)26/h1-4H,5-9H2.
What are the key properties of 1-[3,3-bis(trifluoromethyl)pyrrolidin-1-yl]-3-(4-nitrophenoxy)propan-1-one?
1-[3,3-bis(trifluoromethyl)pyrrolidin-1-yl]-3-(4-nitrophenoxy)propan-1-one has a molecular weight of 400.28 g/mol, XLogP of 3.71, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3,3-bis(trifluoromethyl)pyrrolidin-1-yl]-3-(4-nitrophenoxy)propan-1-one is sourced from PubChem (CID 91642947), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).