C15H14F6N2O4 — CID 91642947
1-[3,3-bis(trifluoromethyl)pyrrolidin-1-yl]-3-(4-nitrophenoxy)propan-1-one (PubChem CID 91642947) has the molecular formula C15H14F6N2O4 and a molecular weight of 400.28 g/mol. Its IUPAC name is 1-[3,3-bis(trifluoromethyl)pyrrolidin-1-yl]-3-(4-nitrophenoxy)propan-1-one.
| Compound Name | 1-[3,3-bis(trifluoromethyl)pyrrolidin-1-yl]-3-(4-nitrophenoxy)propan-1-one |
|---|---|
| PubChem CID | 91642947 |
| Molecular Formula | C15H14F6N2O4 |
| Molecular Weight | 400.28 g/mol |
| Exact Mass | 400.09 |
| IUPAC Name | 1-[3,3-bis(trifluoromethyl)pyrrolidin-1-yl]-3-(4-nitrophenoxy)propan-1-one |
| SMILES | O=C(CCOc1ccc([N+](=O)[O-])cc1)N1CCC(C(F)(F)F)(C(F)(F)F)C1 |
| InChI | InChI=1S/C15H14F6N2O4/c16-14(17,18)13(15(19,20)21)6-7-22(9-13)12(24)5-8-27-11-3-1-10(2-4-11)23(25)26/h1-4H,5-9H2 |
| InChIKey | YJEQMPWYPXIAFG-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.28 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|