C18H17Cl2N3O — CID 91645125
3-amino-N-[2-(6-chloro-3-pyridinyl)ethyl]naphthalene-2-carboxamide;hydrochloride (PubChem CID 91645125) has the molecular formula C18H17Cl2N3O and a molecular weight of 362.26 g/mol. Its IUPAC name is 3-amino-N-[2-(6-chloro-3-pyridinyl)ethyl]naphthalene-2-carboxamide;hydrochloride.
| Compound Name | 3-amino-N-[2-(6-chloro-3-pyridinyl)ethyl]naphthalene-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 91645125 |
| Molecular Formula | C18H17Cl2N3O |
| Molecular Weight | 362.26 g/mol |
| Exact Mass | 361.07 |
| IUPAC Name | 3-amino-N-[2-(6-chloro-3-pyridinyl)ethyl]naphthalene-2-carboxamide;hydrochloride |
| SMILES | Cl.Nc1cc2ccccc2cc1C(=O)NCCc1ccc(Cl)nc1 |
| InChI | InChI=1S/C18H16ClN3O.ClH/c19-17-6-5-12(11-22-17)7-8-21-18(23)15-9-13-3-1-2-4-14(13)10-16(15)20;/h1-6,9-11H,7-8,20H2,(H,21,23);1H |
| InChIKey | PCFZXUPYMNHGDB-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.26 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|