C19H25Cl2N3O2 — CID 91645725
N-[2-(4-methylphenyl)-1-pyridin-3-ylethyl]morpholine-2-carboxamide;dihydrochloride (PubChem CID 91645725) has the molecular formula C19H25Cl2N3O2 and a molecular weight of 398.33 g/mol. Its IUPAC name is N-[2-(4-methylphenyl)-1-pyridin-3-ylethyl]morpholine-2-carboxamide;dihydrochloride.
| Compound Name | N-[2-(4-methylphenyl)-1-pyridin-3-ylethyl]morpholine-2-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 91645725 |
| Molecular Formula | C19H25Cl2N3O2 |
| Molecular Weight | 398.33 g/mol |
| Exact Mass | 397.13 |
| IUPAC Name | N-[2-(4-methylphenyl)-1-pyridin-3-ylethyl]morpholine-2-carboxamide;dihydrochloride |
| SMILES | Cc1ccc(CC(NC(=O)C2CNCCO2)c2cccnc2)cc1.Cl.Cl |
| InChI | InChI=1S/C19H23N3O2.2ClH/c1-14-4-6-15(7-5-14)11-17(16-3-2-8-20-12-16)22-19(23)18-13-21-9-10-24-18;;/h2-8,12,17-18,21H,9-11,13H2,1H3,(H,22,23);2*1H |
| InChIKey | QGJXLGNATVEERM-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.33 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |