C29H35N3O2 — CID 175079955
3-(4-methylphenyl)-2-[2-[1-(4-methylphenyl)ethylamino]anilino]-1-morpholin-2-ylpropan-1-one (PubChem CID 175079955) has the molecular formula C29H35N3O2 and a molecular weight of 457.62 g/mol. Its IUPAC name is 3-(4-methylphenyl)-2-[2-[1-(4-methylphenyl)ethylamino]anilino]-1-morpholin-2-ylpropan-1-one.
| Compound Name | 3-(4-methylphenyl)-2-[2-[1-(4-methylphenyl)ethylamino]anilino]-1-morpholin-2-ylpropan-1-one |
|---|---|
| PubChem CID | 175079955 |
| Molecular Formula | C29H35N3O2 |
| Molecular Weight | 457.62 g/mol |
| Exact Mass | 457.27 |
| IUPAC Name | 3-(4-methylphenyl)-2-[2-[1-(4-methylphenyl)ethylamino]anilino]-1-morpholin-2-ylpropan-1-one |
| SMILES | Cc1ccc(CC(Nc2ccccc2NC(C)c2ccc(C)cc2)C(=O)C2CNCCO2)cc1 |
| InChI | InChI=1S/C29H35N3O2/c1-20-8-12-23(13-9-20)18-27(29(33)28-19-30-16-17-34-28)32-26-7-5-4-6-25(26)31-22(3)24-14-10-21(2)11-15-24/h4-15,22,27-28,30-32H,16-19H2,1-3H3 |
| InChIKey | ZJGMKEIDVQXLCB-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.62 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_NH_alk_C(2)', 'substructure': 'N/A'} |
|---|