C16H25ClN2O3S — CID 91645891
3-amino-N-(3-methylsulfonylcyclohexyl)-3-phenylpropanamide;hydrochloride (PubChem CID 91645891) has the molecular formula C16H25ClN2O3S and a molecular weight of 360.91 g/mol. Its IUPAC name is 3-amino-N-(3-methylsulfonylcyclohexyl)-3-phenylpropanamide;hydrochloride.
| Compound Name | 3-amino-N-(3-methylsulfonylcyclohexyl)-3-phenylpropanamide;hydrochloride |
|---|---|
| PubChem CID | 91645891 |
| Molecular Formula | C16H25ClN2O3S |
| Molecular Weight | 360.91 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | 3-amino-N-(3-methylsulfonylcyclohexyl)-3-phenylpropanamide;hydrochloride |
| SMILES | CS(=O)(=O)C1CCCC(NC(=O)CC(N)c2ccccc2)C1.Cl |
| InChI | InChI=1S/C16H24N2O3S.ClH/c1-22(20,21)14-9-5-8-13(10-14)18-16(19)11-15(17)12-6-3-2-4-7-12;/h2-4,6-7,13-15H,5,8-11,17H2,1H3,(H,18,19);1H |
| InChIKey | DGADDYQCSHGXPL-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.91 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |