C16H22O4S — CID 116751376
2-methoxy-1-(3-methylsulfonylcyclohexyl)-2-phenylethanone (PubChem CID 116751376) has the molecular formula C16H22O4S and a molecular weight of 310.41 g/mol. Its IUPAC name is 2-methoxy-1-(3-methylsulfonylcyclohexyl)-2-phenylethanone.
| Compound Name | 2-methoxy-1-(3-methylsulfonylcyclohexyl)-2-phenylethanone |
|---|---|
| PubChem CID | 116751376 |
| Molecular Formula | C16H22O4S |
| Molecular Weight | 310.41 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | 2-methoxy-1-(3-methylsulfonylcyclohexyl)-2-phenylethanone |
| SMILES | COC(C(=O)C1CCCC(S(C)(=O)=O)C1)c1ccccc1 |
| InChI | InChI=1S/C16H22O4S/c1-20-16(12-7-4-3-5-8-12)15(17)13-9-6-10-14(11-13)21(2,18)19/h3-5,7-8,13-14,16H,6,9-11H2,1-2H3 |
| InChIKey | MEPTYKRILXMYDK-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.41 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |