C18H21N3O4S — CID 9164619
4-[[2-[(2,5-dimethylphenyl)sulfonylamino]acetyl]amino]-N-methylbenzamide (PubChem CID 9164619) has the molecular formula C18H21N3O4S and a molecular weight of 375.45 g/mol. Its IUPAC name is 4-[[2-[(2,5-dimethylphenyl)sulfonylamino]acetyl]amino]-N-methylbenzamide.
| Compound Name | 4-[[2-[(2,5-dimethylphenyl)sulfonylamino]acetyl]amino]-N-methylbenzamide |
|---|---|
| PubChem CID | 9164619 |
| Molecular Formula | C18H21N3O4S |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | 4-[[2-[(2,5-dimethylphenyl)sulfonylamino]acetyl]amino]-N-methylbenzamide |
| SMILES | CNC(=O)c1ccc(NC(=O)CNS(=O)(=O)c2cc(C)ccc2C)cc1 |
| InChI | InChI=1S/C18H21N3O4S/c1-12-4-5-13(2)16(10-12)26(24,25)20-11-17(22)21-15-8-6-14(7-9-15)18(23)19-3/h4-10,20H,11H2,1-3H3,(H,19,23)(H,21,22) |
| InChIKey | LZPLMMVOONPIIZ-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |