C6H9NO2 — CID 91647658
(1R)-1-(5-methyl-1,2-oxazol-3-yl)ethanol (PubChem CID 91647658) has the molecular formula C6H9NO2 and a molecular weight of 127.14 g/mol. Its IUPAC name is (1R)-1-(5-methyl-1,2-oxazol-3-yl)ethanol.
| Compound Name | (1R)-1-(5-methyl-1,2-oxazol-3-yl)ethanol |
|---|---|
| PubChem CID | 91647658 |
| Molecular Formula | C6H9NO2 |
| Molecular Weight | 127.14 g/mol |
| Exact Mass | 127.06 |
| IUPAC Name | (1R)-1-(5-methyl-1,2-oxazol-3-yl)ethanol |
| SMILES | Cc1cc([C@@H](C)O)no1 |
| InChI | InChI=1S/C6H9NO2/c1-4-3-6(5(2)8)7-9-4/h3,5,8H,1-2H3/t5-/m1/s1 |
| InChIKey | BRPQABWKQYZYQC-RXMQYKEDSA-N |
| XLogP | 1.04 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 127.14 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |