C12H11F3N4O3S — CID 91648392
2-[4-nitro-3-(trifluoromethyl)pyrazol-1-yl]-N-(1-thiophen-2-ylethyl)acetamide (PubChem CID 91648392) has the molecular formula C12H11F3N4O3S and a molecular weight of 348.31 g/mol. Its IUPAC name is 2-[4-nitro-3-(trifluoromethyl)pyrazol-1-yl]-N-(1-thiophen-2-ylethyl)acetamide.
| Compound Name | 2-[4-nitro-3-(trifluoromethyl)pyrazol-1-yl]-N-(1-thiophen-2-ylethyl)acetamide |
|---|---|
| PubChem CID | 91648392 |
| Molecular Formula | C12H11F3N4O3S |
| Molecular Weight | 348.31 g/mol |
| Exact Mass | 348.05 |
| IUPAC Name | 2-[4-nitro-3-(trifluoromethyl)pyrazol-1-yl]-N-(1-thiophen-2-ylethyl)acetamide |
| SMILES | CC(NC(=O)Cn1cc([N+](=O)[O-])c(C(F)(F)F)n1)c1cccs1 |
| InChI | InChI=1S/C12H11F3N4O3S/c1-7(9-3-2-4-23-9)16-10(20)6-18-5-8(19(21)22)11(17-18)12(13,14)15/h2-5,7H,6H2,1H3,(H,16,20) |
| InChIKey | UWTMDNYZEXIMJN-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 90.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.31 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|