C16H20ClFN2O2 — CID 91650770
1-[2-(2-chloro-6-fluorophenyl)ethyl]-3-(2-oxabicyclo[4.2.0]octan-7-yl)urea (PubChem CID 91650770) has the molecular formula C16H20ClFN2O2 and a molecular weight of 326.80 g/mol. Its IUPAC name is 1-[2-(2-chloro-6-fluorophenyl)ethyl]-3-(2-oxabicyclo[4.2.0]octan-7-yl)urea.
| Compound Name | 1-[2-(2-chloro-6-fluorophenyl)ethyl]-3-(2-oxabicyclo[4.2.0]octan-7-yl)urea |
|---|---|
| PubChem CID | 91650770 |
| Molecular Formula | C16H20ClFN2O2 |
| Molecular Weight | 326.80 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | 1-[2-(2-chloro-6-fluorophenyl)ethyl]-3-(2-oxabicyclo[4.2.0]octan-7-yl)urea |
| SMILES | O=C(NCCc1c(F)cccc1Cl)NC1CC2OCCCC12 |
| InChI | InChI=1S/C16H20ClFN2O2/c17-12-4-1-5-13(18)10(12)6-7-19-16(21)20-14-9-15-11(14)3-2-8-22-15/h1,4-5,11,14-15H,2-3,6-9H2,(H2,19,20,21) |
| InChIKey | WJXAQHVBPOBSSQ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.80 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |