C20H14F4N2O3 — CID 91651889
N-[[6-(4-fluorophenoxy)-3-pyridinyl]methyl]-5-hydroxy-2-(trifluoromethyl)benzamide (PubChem CID 91651889) has the molecular formula C20H14F4N2O3 and a molecular weight of 406.34 g/mol. Its IUPAC name is N-[[6-(4-fluorophenoxy)-3-pyridinyl]methyl]-5-hydroxy-2-(trifluoromethyl)benzamide.
| Compound Name | N-[[6-(4-fluorophenoxy)-3-pyridinyl]methyl]-5-hydroxy-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 91651889 |
| Molecular Formula | C20H14F4N2O3 |
| Molecular Weight | 406.34 g/mol |
| Exact Mass | 406.09 |
| IUPAC Name | N-[[6-(4-fluorophenoxy)-3-pyridinyl]methyl]-5-hydroxy-2-(trifluoromethyl)benzamide |
| SMILES | O=C(NCc1ccc(Oc2ccc(F)cc2)nc1)c1cc(O)ccc1C(F)(F)F |
| InChI | InChI=1S/C20H14F4N2O3/c21-13-2-5-15(6-3-13)29-18-8-1-12(10-25-18)11-26-19(28)16-9-14(27)4-7-17(16)20(22,23)24/h1-10,27H,11H2,(H,26,28) |
| InChIKey | NYGMFHBZGBRPDV-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.34 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |