C10H9ClN4O2S2 — CID 91651974
5-chloro-N-(4-cyano-5-methyl-1H-pyrazol-3-yl)-4-methylthiophene-2-sulfonamide (PubChem CID 91651974) has the molecular formula C10H9ClN4O2S2 and a molecular weight of 316.80 g/mol. Its IUPAC name is 5-chloro-N-(4-cyano-5-methyl-1H-pyrazol-3-yl)-4-methylthiophene-2-sulfonamide.
| Compound Name | 5-chloro-N-(4-cyano-5-methyl-1H-pyrazol-3-yl)-4-methylthiophene-2-sulfonamide |
|---|---|
| PubChem CID | 91651974 |
| Molecular Formula | C10H9ClN4O2S2 |
| Molecular Weight | 316.80 g/mol |
| Exact Mass | 315.99 |
| IUPAC Name | 5-chloro-N-(4-cyano-5-methyl-1H-pyrazol-3-yl)-4-methylthiophene-2-sulfonamide |
| SMILES | Cc1cc(S(=O)(=O)Nc2n[nH]c(C)c2C#N)sc1Cl |
| InChI | InChI=1S/C10H9ClN4O2S2/c1-5-3-8(18-9(5)11)19(16,17)15-10-7(4-12)6(2)13-14-10/h3H,1-2H3,(H2,13,14,15) |
| InChIKey | UUTVJVZGGFXLSJ-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 98.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.80 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |