C11H8ClFN4O2S — CID 86803070
2-chloro-N-(4-cyano-5-methyl-1H-pyrazol-3-yl)-6-fluorobenzenesulfonamide (PubChem CID 86803070) has the molecular formula C11H8ClFN4O2S and a molecular weight of 314.73 g/mol. Its IUPAC name is 2-chloro-N-(4-cyano-5-methyl-1H-pyrazol-3-yl)-6-fluorobenzenesulfonamide.
| Compound Name | 2-chloro-N-(4-cyano-5-methyl-1H-pyrazol-3-yl)-6-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 86803070 |
| Molecular Formula | C11H8ClFN4O2S |
| Molecular Weight | 314.73 g/mol |
| Exact Mass | 314.00 |
| IUPAC Name | 2-chloro-N-(4-cyano-5-methyl-1H-pyrazol-3-yl)-6-fluorobenzenesulfonamide |
| SMILES | Cc1[nH]nc(NS(=O)(=O)c2c(F)cccc2Cl)c1C#N |
| InChI | InChI=1S/C11H8ClFN4O2S/c1-6-7(5-14)11(16-15-6)17-20(18,19)10-8(12)3-2-4-9(10)13/h2-4H,1H3,(H2,15,16,17) |
| InChIKey | VZZVROUREMQYRP-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 98.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.73 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |