C13H12ClFN2O2S — CID 91661732
2-chloro-N-(2,6-dimethyl-3-pyridinyl)-6-fluorobenzenesulfonamide (PubChem CID 91661732) has the molecular formula C13H12ClFN2O2S and a molecular weight of 314.77 g/mol. Its IUPAC name is 2-chloro-N-(2,6-dimethyl-3-pyridinyl)-6-fluorobenzenesulfonamide.
| Compound Name | 2-chloro-N-(2,6-dimethyl-3-pyridinyl)-6-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 91661732 |
| Molecular Formula | C13H12ClFN2O2S |
| Molecular Weight | 314.77 g/mol |
| Exact Mass | 314.03 |
| IUPAC Name | 2-chloro-N-(2,6-dimethyl-3-pyridinyl)-6-fluorobenzenesulfonamide |
| SMILES | Cc1ccc(NS(=O)(=O)c2c(F)cccc2Cl)c(C)n1 |
| InChI | InChI=1S/C13H12ClFN2O2S/c1-8-6-7-12(9(2)16-8)17-20(18,19)13-10(14)4-3-5-11(13)15/h3-7,17H,1-2H3 |
| InChIKey | XWLVAIMYPSHLGE-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.77 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |