C11H10ClN5O2S — CID 80703861
N-(4-amino-5-methyl-1H-pyrazol-3-yl)-2-chloro-5-cyanobenzenesulfonamide (PubChem CID 80703861) has the molecular formula C11H10ClN5O2S and a molecular weight of 311.75 g/mol. Its IUPAC name is N-(4-amino-5-methyl-1H-pyrazol-3-yl)-2-chloro-5-cyanobenzenesulfonamide.
| Compound Name | N-(4-amino-5-methyl-1H-pyrazol-3-yl)-2-chloro-5-cyanobenzenesulfonamide |
|---|---|
| PubChem CID | 80703861 |
| Molecular Formula | C11H10ClN5O2S |
| Molecular Weight | 311.75 g/mol |
| Exact Mass | 311.02 |
| IUPAC Name | N-(4-amino-5-methyl-1H-pyrazol-3-yl)-2-chloro-5-cyanobenzenesulfonamide |
| SMILES | Cc1[nH]nc(NS(=O)(=O)c2cc(C#N)ccc2Cl)c1N |
| InChI | InChI=1S/C11H10ClN5O2S/c1-6-10(14)11(16-15-6)17-20(18,19)9-4-7(5-13)2-3-8(9)12/h2-4H,14H2,1H3,(H2,15,16,17) |
| InChIKey | SVZRWKLMQUFAHP-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 124.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.75 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |