C20H25NO4S — CID 91652928
N-[[4-(2-hydroxyethylsulfonyl)phenyl]methyl]-3-methyl-3-phenylbutanamide (PubChem CID 91652928) has the molecular formula C20H25NO4S and a molecular weight of 375.49 g/mol. Its IUPAC name is N-[[4-(2-hydroxyethylsulfonyl)phenyl]methyl]-3-methyl-3-phenylbutanamide.
| Compound Name | N-[[4-(2-hydroxyethylsulfonyl)phenyl]methyl]-3-methyl-3-phenylbutanamide |
|---|---|
| PubChem CID | 91652928 |
| Molecular Formula | C20H25NO4S |
| Molecular Weight | 375.49 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | N-[[4-(2-hydroxyethylsulfonyl)phenyl]methyl]-3-methyl-3-phenylbutanamide |
| SMILES | CC(C)(CC(=O)NCc1ccc(S(=O)(=O)CCO)cc1)c1ccccc1 |
| InChI | InChI=1S/C20H25NO4S/c1-20(2,17-6-4-3-5-7-17)14-19(23)21-15-16-8-10-18(11-9-16)26(24,25)13-12-22/h3-11,22H,12-15H2,1-2H3,(H,21,23) |
| InChIKey | CPETYUZKIAFLRB-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.49 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |