C21H19ClN2O3S — CID 9165300
N-[(2-chlorophenyl)methyl]-2-[2-(furan-2-ylmethylamino)-2-oxoethyl]sulfanylbenzamide (PubChem CID 9165300) has the molecular formula C21H19ClN2O3S and a molecular weight of 414.91 g/mol. Its IUPAC name is N-[(2-chlorophenyl)methyl]-2-[2-(furan-2-ylmethylamino)-2-oxoethyl]sulfanylbenzamide.
| Compound Name | N-[(2-chlorophenyl)methyl]-2-[2-(furan-2-ylmethylamino)-2-oxoethyl]sulfanylbenzamide |
|---|---|
| PubChem CID | 9165300 |
| Molecular Formula | C21H19ClN2O3S |
| Molecular Weight | 414.91 g/mol |
| Exact Mass | 414.08 |
| IUPAC Name | N-[(2-chlorophenyl)methyl]-2-[2-(furan-2-ylmethylamino)-2-oxoethyl]sulfanylbenzamide |
| SMILES | O=C(CSc1ccccc1C(=O)NCc1ccccc1Cl)NCc1ccco1 |
| InChI | InChI=1S/C21H19ClN2O3S/c22-18-9-3-1-6-15(18)12-24-21(26)17-8-2-4-10-19(17)28-14-20(25)23-13-16-7-5-11-27-16/h1-11H,12-14H2,(H,23,25)(H,24,26) |
| InChIKey | GWSLMASRLYZUJQ-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.91 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |