C23H19N3O3S — CID 8024111
2-[2-(furan-2-ylmethylamino)-2-oxoethyl]sulfanyl-N-quinolin-8-ylbenzamide (PubChem CID 8024111) has the molecular formula C23H19N3O3S and a molecular weight of 417.49 g/mol. Its IUPAC name is 2-[2-(furan-2-ylmethylamino)-2-oxoethyl]sulfanyl-N-quinolin-8-ylbenzamide.
| Compound Name | 2-[2-(furan-2-ylmethylamino)-2-oxoethyl]sulfanyl-N-quinolin-8-ylbenzamide |
|---|---|
| PubChem CID | 8024111 |
| Molecular Formula | C23H19N3O3S |
| Molecular Weight | 417.49 g/mol |
| Exact Mass | 417.11 |
| IUPAC Name | 2-[2-(furan-2-ylmethylamino)-2-oxoethyl]sulfanyl-N-quinolin-8-ylbenzamide |
| SMILES | O=C(CSc1ccccc1C(=O)Nc1cccc2cccnc12)NCc1ccco1 |
| InChI | InChI=1S/C23H19N3O3S/c27-21(25-14-17-8-5-13-29-17)15-30-20-11-2-1-9-18(20)23(28)26-19-10-3-6-16-7-4-12-24-22(16)19/h1-13H,14-15H2,(H,25,27)(H,26,28) |
| InChIKey | VTUIPIMQKDPKHV-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.49 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |