C10H13F3N2O2S — CID 91659844
N-(1-amino-2-methylpropan-2-yl)-3,4,5-trifluorobenzenesulfonamide (PubChem CID 91659844) has the molecular formula C10H13F3N2O2S and a molecular weight of 282.29 g/mol. Its IUPAC name is N-(1-amino-2-methylpropan-2-yl)-3,4,5-trifluorobenzenesulfonamide.
| Compound Name | N-(1-amino-2-methylpropan-2-yl)-3,4,5-trifluorobenzenesulfonamide |
|---|---|
| PubChem CID | 91659844 |
| Molecular Formula | C10H13F3N2O2S |
| Molecular Weight | 282.29 g/mol |
| Exact Mass | 282.06 |
| IUPAC Name | N-(1-amino-2-methylpropan-2-yl)-3,4,5-trifluorobenzenesulfonamide |
| SMILES | CC(C)(CN)NS(=O)(=O)c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C10H13F3N2O2S/c1-10(2,5-14)15-18(16,17)6-3-7(11)9(13)8(12)4-6/h3-4,15H,5,14H2,1-2H3 |
| InChIKey | ZWMLNGPNTRDRPW-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.29 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|